C14H20INO2S — CID 163613729
N-[(2R)-2-(4-iodophenyl)cyclopentyl]propane-2-sulfonamide (PubChem CID 163613729) has the molecular formula C14H20INO2S and a molecular weight of 393.29 g/mol. Its IUPAC name is N-[(2R)-2-(4-iodophenyl)cyclopentyl]propane-2-sulfonamide.
| Compound Name | N-[(2R)-2-(4-iodophenyl)cyclopentyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 163613729 |
| Molecular Formula | C14H20INO2S |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | N-[(2R)-2-(4-iodophenyl)cyclopentyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NC1CCC[C@@H]1c1ccc(I)cc1 |
| InChI | InChI=1S/C14H20INO2S/c1-10(2)19(17,18)16-14-5-3-4-13(14)11-6-8-12(15)9-7-11/h6-10,13-14,16H,3-5H2,1-2H3/t13-,14?/m1/s1 |
| InChIKey | HIEFOCVVJHTIMX-KWCCSABGSA-N |
| XLogP | 3.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|