C21H24F2N2O3S — CID 59103276
3,5-difluoro-N-[4-[(1R,2R)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]benzamide (PubChem CID 59103276) has the molecular formula C21H24F2N2O3S and a molecular weight of 422.50 g/mol. Its IUPAC name is 3,5-difluoro-N-[4-[(1R,2R)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]benzamide.
| Compound Name | 3,5-difluoro-N-[4-[(1R,2R)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]benzamide |
|---|---|
| PubChem CID | 59103276 |
| Molecular Formula | C21H24F2N2O3S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 3,5-difluoro-N-[4-[(1R,2R)-2-(propan-2-ylsulfonylamino)cyclopentyl]phenyl]benzamide |
| SMILES | CC(C)S(=O)(=O)N[C@@H]1CCC[C@@H]1c1ccc(NC(=O)c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C21H24F2N2O3S/c1-13(2)29(27,28)25-20-5-3-4-19(20)14-6-8-18(9-7-14)24-21(26)15-10-16(22)12-17(23)11-15/h6-13,19-20,25H,3-5H2,1-2H3,(H,24,26)/t19-,20-/m1/s1 |
| InChIKey | CWPTVIBFJARZEG-WOJBJXKFSA-N |
| XLogP | 4.18 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |