C13H19IN2O2S — CID 142068467
1-[(1R,2R)-2-(dimethylsulfamoylamino)cyclopentyl]-4-iodobenzene (PubChem CID 142068467) has the molecular formula C13H19IN2O2S and a molecular weight of 394.28 g/mol. Its IUPAC name is 1-[(1R,2R)-2-(dimethylsulfamoylamino)cyclopentyl]-4-iodobenzene.
| Compound Name | 1-[(1R,2R)-2-(dimethylsulfamoylamino)cyclopentyl]-4-iodobenzene |
|---|---|
| PubChem CID | 142068467 |
| Molecular Formula | C13H19IN2O2S |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 1-[(1R,2R)-2-(dimethylsulfamoylamino)cyclopentyl]-4-iodobenzene |
| SMILES | CN(C)S(=O)(=O)N[C@@H]1CCC[C@@H]1c1ccc(I)cc1 |
| InChI | InChI=1S/C13H19IN2O2S/c1-16(2)19(17,18)15-13-5-3-4-12(13)10-6-8-11(14)9-7-10/h6-9,12-13,15H,3-5H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | UQXSPDYPMVOKLY-CHWSQXEVSA-N |
| XLogP | 2.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|