C8H10N4 — CID 59106726
N'-(5-isocyano-2-pyridinyl)ethane-1,2-diamine (PubChem CID 59106726) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is N'-(5-isocyano-2-pyridinyl)ethane-1,2-diamine.
| Compound Name | N'-(5-isocyano-2-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 59106726 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | N'-(5-isocyano-2-pyridinyl)ethane-1,2-diamine |
| SMILES | [C-]#[N+]c1ccc(NCCN)nc1 |
| InChI | InChI=1S/C8H10N4/c1-10-7-2-3-8(12-6-7)11-5-4-9/h2-3,6H,4-5,9H2,(H,11,12) |
| InChIKey | YGMMFXTWSSUVNX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 55.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|