C20H33N2O3+ — CID 59107228
(2-hydroxy-3-propan-2-yloxypropyl)-dimethyl-[3-(3-phenylprop-2-enoylamino)propyl]azanium (PubChem CID 59107228) has the molecular formula C20H33N2O3+ and a molecular weight of 349.50 g/mol. Its IUPAC name is (2-hydroxy-3-propan-2-yloxypropyl)-dimethyl-[3-(3-phenylprop-2-enoylamino)propyl]azanium.
| Compound Name | (2-hydroxy-3-propan-2-yloxypropyl)-dimethyl-[3-(3-phenylprop-2-enoylamino)propyl]azanium |
|---|---|
| PubChem CID | 59107228 |
| Molecular Formula | C20H33N2O3+ |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | (2-hydroxy-3-propan-2-yloxypropyl)-dimethyl-[3-(3-phenylprop-2-enoylamino)propyl]azanium |
| SMILES | CC(C)OCC(O)C[N+](C)(C)CCCNC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C20H32N2O3/c1-17(2)25-16-19(23)15-22(3,4)14-8-13-21-20(24)12-11-18-9-6-5-7-10-18/h5-7,9-12,17,19,23H,8,13-16H2,1-4H3/p+1 |
| InChIKey | WWPTTZZFOXQOHP-UHFFFAOYSA-O |
| XLogP | 2.07 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|