C22H20F3N7O — CID 59112393
N'-(4-morpholin-4-ylanilino)-N-pyrimidin-2-ylimino-4-(trifluoromethyl)benzenecarboximidamide (PubChem CID 59112393) has the molecular formula C22H20F3N7O and a molecular weight of 455.44 g/mol. Its IUPAC name is N'-(4-morpholin-4-ylanilino)-N-pyrimidin-2-ylimino-4-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | N'-(4-morpholin-4-ylanilino)-N-pyrimidin-2-ylimino-4-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 59112393 |
| Molecular Formula | C22H20F3N7O |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N'-(4-morpholin-4-ylanilino)-N-pyrimidin-2-ylimino-4-(trifluoromethyl)benzenecarboximidamide |
| SMILES | FC(F)(F)c1ccc(C(=N/Nc2ccc(N3CCOCC3)cc2)/N=N/c2ncccn2)cc1 |
| InChI | InChI=1S/C22H20F3N7O/c23-22(24,25)17-4-2-16(3-5-17)20(30-31-21-26-10-1-11-27-21)29-28-18-6-8-19(9-7-18)32-12-14-33-15-13-32/h1-11,28H,12-15H2/b29-20-,31-30+ |
| InChIKey | NCRZPXBKKNRUSB-PRNCLZLASA-N |
| XLogP | 4.89 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|