About [5-hydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)ethynyl]-4-methoxyphenyl] 2-iodoacetate;praseodymium
[5-hydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)ethynyl]-4-methoxyphenyl] 2-iodoacetate;praseodymium (PubChem CID 59113951) has the molecular formula C18H15IO6Pr2
and a molecular weight of 736.03 g/mol. Its IUPAC name is [5-hydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)ethynyl]-4-methoxyphenyl] 2-iodoacetate;praseodymium.
Molecular Properties
| Compound Name | [5-hydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)ethynyl]-4-methoxyphenyl] 2-iodoacetate;praseodymium |
| PubChem CID | 59113951 |
| Molecular Formula | C18H15IO6Pr2 |
| Molecular Weight | 736.03 g/mol |
| Exact Mass | 735.81 |
| IUPAC Name | [5-hydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)ethynyl]-4-methoxyphenyl] 2-iodoacetate;praseodymium |
| SMILES | COc1cc(C#Cc2cc(OC)c(O)cc2OC(=O)CI)ccc1O.[Pr].[Pr] |
| InChI | InChI=1S/C18H15IO6.2Pr/c1-23-16-7-11(4-6-13(16)20)3-5-12-8-17(24-2)14(21)9-15(12)25-18(22)10-19;;/h4,6-9,20-21H,10H2,1-2H3;; |
| InChIKey | ZVHTYBBHXLARTD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 736.03 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-hydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)ethynyl]-4-methoxyphenyl] 2-iodoacetate;praseodymium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-hydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)ethynyl]-4-methoxyphenyl] 2-iodoacetate;praseodymium?
The IUPAC name of [5-hydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)ethynyl]-4-methoxyphenyl] 2-iodoacetate;praseodymium (CID 59113951) is [5-hydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)ethynyl]-4-methoxyphenyl] 2-iodoacetate;praseodymium.
What is the SMILES notation for [5-hydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)ethynyl]-4-methoxyphenyl] 2-iodoacetate;praseodymium?
The canonical SMILES for [5-hydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)ethynyl]-4-methoxyphenyl] 2-iodoacetate;praseodymium is COc1cc(C#Cc2cc(OC)c(O)cc2OC(=O)CI)ccc1O.[Pr].[Pr].
What is the InChIKey of [5-hydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)ethynyl]-4-methoxyphenyl] 2-iodoacetate;praseodymium?
The InChIKey is ZVHTYBBHXLARTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15IO6.2Pr/c1-23-16-7-11(4-6-13(16)20)3-5-12-8-17(24-2)14(21)9-15(12)25-18(22)10-19;;/h4,6-9,20-21H,10H2,1-2H3;;.
What are the key properties of [5-hydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)ethynyl]-4-methoxyphenyl] 2-iodoacetate;praseodymium?
[5-hydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)ethynyl]-4-methoxyphenyl] 2-iodoacetate;praseodymium has a molecular weight of 736.03 g/mol, XLogP of 2.86, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-hydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)ethynyl]-4-methoxyphenyl] 2-iodoacetate;praseodymium is sourced from PubChem (CID 59113951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).