C28H44N4O8 — CID 59115541
6-[(1R,2S,5S)-2-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-5-(2-methylpropoxycarbonylamino)-6-oxohexanoic acid (PubChem CID 59115541) has the molecular formula C28H44N4O8 and a molecular weight of 564.68 g/mol. Its IUPAC name is 6-[(1R,2S,5S)-2-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-5-(2-methylpropoxycarbonylamino)-6-oxohexanoic acid.
| Compound Name | 6-[(1R,2S,5S)-2-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-5-(2-methylpropoxycarbonylamino)-6-oxohexanoic acid |
|---|---|
| PubChem CID | 59115541 |
| Molecular Formula | C28H44N4O8 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | 6-[(1R,2S,5S)-2-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-5-(2-methylpropoxycarbonylamino)-6-oxohexanoic acid |
| SMILES | C=CCNC(=O)C(=O)C(CCC)NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)C(CCCC(=O)O)NC(=O)OCC(C)C)C2(C)C |
| InChI | InChI=1S/C28H44N4O8/c1-7-10-18(23(35)25(37)29-13-8-2)30-24(36)22-21-17(28(21,5)6)14-32(22)26(38)19(11-9-12-20(33)34)31-27(39)40-15-16(3)4/h8,16-19,21-22H,2,7,9-15H2,1,3-6H3,(H,29,37)(H,30,36)(H,31,39)(H,33,34)/t17-,18?,19?,21-,22-/m0/s1 |
| InChIKey | QJTIQPGUSHLHLI-LYRWKLJTSA-N |
| XLogP | 1.63 |
| TPSA | 171.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|