C21H32F2O5 — CID 59116002
methyl (Z)-7-[(4aR,5R,7aR)-2-(1,1-difluoropentyl)-2-hydroxy-6-oxo-3,4,4a,5,7,7a-hexahydrocyclopenta[b]pyran-5-yl]hept-5-enoate (PubChem CID 59116002) has the molecular formula C21H32F2O5 and a molecular weight of 402.48 g/mol. Its IUPAC name is methyl (Z)-7-[(4aR,5R,7aR)-2-(1,1-difluoropentyl)-2-hydroxy-6-oxo-3,4,4a,5,7,7a-hexahydrocyclopenta[b]pyran-5-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(4aR,5R,7aR)-2-(1,1-difluoropentyl)-2-hydroxy-6-oxo-3,4,4a,5,7,7a-hexahydrocyclopenta[b]pyran-5-yl]hept-5-enoate |
|---|---|
| PubChem CID | 59116002 |
| Molecular Formula | C21H32F2O5 |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | methyl (Z)-7-[(4aR,5R,7aR)-2-(1,1-difluoropentyl)-2-hydroxy-6-oxo-3,4,4a,5,7,7a-hexahydrocyclopenta[b]pyran-5-yl]hept-5-enoate |
| SMILES | CCCCC(F)(F)C1(O)CC[C@H]2[C@@H](CC(=O)[C@@H]2C/C=C\CCCC(=O)OC)O1 |
| InChI | InChI=1S/C21H32F2O5/c1-3-4-12-20(22,23)21(26)13-11-16-15(17(24)14-18(16)28-21)9-7-5-6-8-10-19(25)27-2/h5,7,15-16,18,26H,3-4,6,8-14H2,1-2H3/b7-5-/t15-,16-,18-,21?/m1/s1 |
| InChIKey | UCJWMDSSHVDYPI-LDFYRKBUSA-N |
| XLogP | 4.17 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|