About carbanide;1-carboxypentylazanide;vanadium(2+)
carbanide;1-carboxypentylazanide;vanadium(2+) (PubChem CID 59116042) has the molecular formula C7H15NO2V
and a molecular weight of 196.15 g/mol. Its IUPAC name is carbanide;1-carboxypentylazanide;vanadium(2+).
Molecular Properties
| Compound Name | carbanide;1-carboxypentylazanide;vanadium(2+) |
| PubChem CID | 59116042 |
| Molecular Formula | C7H15NO2V |
| Molecular Weight | 196.15 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | carbanide;1-carboxypentylazanide;vanadium(2+) |
| SMILES | CCCCC([NH-])C(=O)O.[CH3-].[V+2] |
| InChI | InChI=1S/C6H12NO2.CH3.V/c1-2-3-4-5(7)6(8)9;;/h5,7H,2-4H2,1H3,(H,8,9);1H3;/q2*-1;+2 |
| InChIKey | QHAQPLPFAYAVAC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 61.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.15 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;1-carboxypentylazanide;vanadium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;1-carboxypentylazanide;vanadium(2+)?
The IUPAC name of carbanide;1-carboxypentylazanide;vanadium(2+) (CID 59116042) is carbanide;1-carboxypentylazanide;vanadium(2+).
What is the SMILES notation for carbanide;1-carboxypentylazanide;vanadium(2+)?
The canonical SMILES for carbanide;1-carboxypentylazanide;vanadium(2+) is CCCCC([NH-])C(=O)O.[CH3-].[V+2].
What is the InChIKey of carbanide;1-carboxypentylazanide;vanadium(2+)?
The InChIKey is QHAQPLPFAYAVAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12NO2.CH3.V/c1-2-3-4-5(7)6(8)9;;/h5,7H,2-4H2,1H3,(H,8,9);1H3;/q2*-1;+2.
What are the key properties of carbanide;1-carboxypentylazanide;vanadium(2+)?
carbanide;1-carboxypentylazanide;vanadium(2+) has a molecular weight of 196.15 g/mol, XLogP of 2.13, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;1-carboxypentylazanide;vanadium(2+) is sourced from PubChem (CID 59116042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).