C21H42O3 — CID 59125140
10-hydroxy-3-(7-hydroxy-6,6-dimethylheptyl)-9,9-dimethyldecan-2-one (PubChem CID 59125140) has the molecular formula C21H42O3 and a molecular weight of 342.56 g/mol. Its IUPAC name is 10-hydroxy-3-(7-hydroxy-6,6-dimethylheptyl)-9,9-dimethyldecan-2-one.
| Compound Name | 10-hydroxy-3-(7-hydroxy-6,6-dimethylheptyl)-9,9-dimethyldecan-2-one |
|---|---|
| PubChem CID | 59125140 |
| Molecular Formula | C21H42O3 |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 342.31 |
| IUPAC Name | 10-hydroxy-3-(7-hydroxy-6,6-dimethylheptyl)-9,9-dimethyldecan-2-one |
| SMILES | CC(=O)C(CCCCCC(C)(C)CO)CCCCCC(C)(C)CO |
| InChI | InChI=1S/C21H42O3/c1-18(24)19(12-8-6-10-14-20(2,3)16-22)13-9-7-11-15-21(4,5)17-23/h19,22-23H,6-17H2,1-5H3 |
| InChIKey | WRYIUTGECCKHQK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|