C22H26O4 — CID 59127477
2-[7-(hydroxymethyl)-5-(2-methylpropyl)-6-phenylmethoxy-1-benzofuran-3-yl]ethanol (PubChem CID 59127477) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-[7-(hydroxymethyl)-5-(2-methylpropyl)-6-phenylmethoxy-1-benzofuran-3-yl]ethanol.
| Compound Name | 2-[7-(hydroxymethyl)-5-(2-methylpropyl)-6-phenylmethoxy-1-benzofuran-3-yl]ethanol |
|---|---|
| PubChem CID | 59127477 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-[7-(hydroxymethyl)-5-(2-methylpropyl)-6-phenylmethoxy-1-benzofuran-3-yl]ethanol |
| SMILES | CC(C)Cc1cc2c(CCO)coc2c(CO)c1OCc1ccccc1 |
| InChI | InChI=1S/C22H26O4/c1-15(2)10-18-11-19-17(8-9-23)14-26-22(19)20(12-24)21(18)25-13-16-6-4-3-5-7-16/h3-7,11,14-15,23-24H,8-10,12-13H2,1-2H3 |
| InChIKey | JZFXPTIAVNQTBO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |