C11H12O6 — CID 59131266
methyl (1S,4R,8S,10S,12S)-4-hydroxy-3,5,11-trioxatetracyclo[6.3.1.01,10.04,12]dodec-6-ene-7-carboxylate (PubChem CID 59131266) has the molecular formula C11H12O6 and a molecular weight of 240.21 g/mol. Its IUPAC name is methyl (1S,4R,8S,10S,12S)-4-hydroxy-3,5,11-trioxatetracyclo[6.3.1.01,10.04,12]dodec-6-ene-7-carboxylate.
| Compound Name | methyl (1S,4R,8S,10S,12S)-4-hydroxy-3,5,11-trioxatetracyclo[6.3.1.01,10.04,12]dodec-6-ene-7-carboxylate |
|---|---|
| PubChem CID | 59131266 |
| Molecular Formula | C11H12O6 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | methyl (1S,4R,8S,10S,12S)-4-hydroxy-3,5,11-trioxatetracyclo[6.3.1.01,10.04,12]dodec-6-ene-7-carboxylate |
| SMILES | COC(=O)C1=CO[C@]2(O)OC[C@]34O[C@H]3C[C@H]1[C@H]24 |
| InChI | InChI=1S/C11H12O6/c1-14-9(12)6-3-15-11(13)8-5(6)2-7-10(8,17-7)4-16-11/h3,5,7-8,13H,2,4H2,1H3/t5-,7+,8+,10+,11+/m1/s1 |
| InChIKey | PYDPUODIIMXZOC-ANRGBQPPSA-N |
| XLogP | -0.48 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|