C48H42N2O12 — CID 59133255
[4-[[3-methyl-4-[2-methyl-4-[[4-(2,4,5-trimethoxybenzoyl)oxybenzoyl]amino]phenyl]phenyl]carbamoyl]phenyl] 2-formyl-4,5-dimethoxybenzoate (PubChem CID 59133255) has the molecular formula C48H42N2O12 and a molecular weight of 838.87 g/mol. Its IUPAC name is [4-[[3-methyl-4-[2-methyl-4-[[4-(2,4,5-trimethoxybenzoyl)oxybenzoyl]amino]phenyl]phenyl]carbamoyl]phenyl] 2-formyl-4,5-dimethoxybenzoate.
| Compound Name | [4-[[3-methyl-4-[2-methyl-4-[[4-(2,4,5-trimethoxybenzoyl)oxybenzoyl]amino]phenyl]phenyl]carbamoyl]phenyl] 2-formyl-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 59133255 |
| Molecular Formula | C48H42N2O12 |
| Molecular Weight | 838.87 g/mol |
| Exact Mass | 838.27 |
| IUPAC Name | [4-[[3-methyl-4-[2-methyl-4-[[4-(2,4,5-trimethoxybenzoyl)oxybenzoyl]amino]phenyl]phenyl]carbamoyl]phenyl] 2-formyl-4,5-dimethoxybenzoate |
| SMILES | COc1cc(C=O)c(C(=O)Oc2ccc(C(=O)Nc3ccc(-c4ccc(NC(=O)c5ccc(OC(=O)c6cc(OC)c(OC)cc6OC)cc5)cc4C)c(C)c3)cc2)cc1OC |
| InChI | InChI=1S/C48H42N2O12/c1-27-20-32(49-45(52)29-8-14-34(15-9-29)61-47(54)38-23-42(58-5)41(57-4)22-31(38)26-51)12-18-36(27)37-19-13-33(21-28(37)2)50-46(53)30-10-16-35(17-11-30)62-48(55)39-24-43(59-6)44(60-7)25-40(39)56-3/h8-26H,1-7H3,(H,49,52)(H,50,53) |
| InChIKey | PCJMFDPLYLSYPT-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 174.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.87 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|