C14H13NO2 — CID 59134398
(11R,13R)-14,14-dimethyl-12,15-dioxa-7-azatetracyclo[8.5.0.03,8.011,13]pentadeca-1(10),2,4,6,8-pentaene (PubChem CID 59134398) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is (11R,13R)-14,14-dimethyl-12,15-dioxa-7-azatetracyclo[8.5.0.03,8.011,13]pentadeca-1(10),2,4,6,8-pentaene.
| Compound Name | (11R,13R)-14,14-dimethyl-12,15-dioxa-7-azatetracyclo[8.5.0.03,8.011,13]pentadeca-1(10),2,4,6,8-pentaene |
|---|---|
| PubChem CID | 59134398 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | (11R,13R)-14,14-dimethyl-12,15-dioxa-7-azatetracyclo[8.5.0.03,8.011,13]pentadeca-1(10),2,4,6,8-pentaene |
| SMILES | CC1(C)Oc2cc3cccnc3cc2[C@H]2O[C@H]21 |
| InChI | InChI=1S/C14H13NO2/c1-14(2)13-12(16-13)9-7-10-8(4-3-5-15-10)6-11(9)17-14/h3-7,12-13H,1-2H3/t12-,13-/m1/s1 |
| InChIKey | JMWYGXKXXKANOH-CHWSQXEVSA-N |
| XLogP | 2.85 |
| TPSA | 34.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|