C18H22ClFN4O — CID 59144919
1-(4-chlorophenyl)-4-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]butan-1-ol (PubChem CID 59144919) has the molecular formula C18H22ClFN4O and a molecular weight of 364.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]butan-1-ol.
| Compound Name | 1-(4-chlorophenyl)-4-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 59144919 |
| Molecular Formula | C18H22ClFN4O |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1-(4-chlorophenyl)-4-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]butan-1-ol |
| SMILES | OC(CCCN1CCN(c2ncc(F)cn2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H22ClFN4O/c19-15-5-3-14(4-6-15)17(25)2-1-7-23-8-10-24(11-9-23)18-21-12-16(20)13-22-18/h3-6,12-13,17,25H,1-2,7-11H2 |
| InChIKey | LEQXOJUKLRHKIE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |