C25H27F2N5O — CID 54386733
N-[1-(4-fluorophenyl)-4-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]butyl]benzamide (PubChem CID 54386733) has the molecular formula C25H27F2N5O and a molecular weight of 451.52 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-4-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]butyl]benzamide.
| Compound Name | N-[1-(4-fluorophenyl)-4-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 54386733 |
| Molecular Formula | C25H27F2N5O |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | N-[1-(4-fluorophenyl)-4-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]butyl]benzamide |
| SMILES | O=C(NC(CCCN1CCN(c2ncc(F)cn2)CC1)c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H27F2N5O/c26-21-10-8-19(9-11-21)23(30-24(33)20-5-2-1-3-6-20)7-4-12-31-13-15-32(16-14-31)25-28-17-22(27)18-29-25/h1-3,5-6,8-11,17-18,23H,4,7,12-16H2,(H,30,33) |
| InChIKey | VDTRJGAICXXJPD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |