C20H24F2N4O2 — CID 56994409
3-(4-fluorophenyl)-6-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]hexanoic acid (PubChem CID 56994409) has the molecular formula C20H24F2N4O2 and a molecular weight of 390.43 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-6-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]hexanoic acid.
| Compound Name | 3-(4-fluorophenyl)-6-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 56994409 |
| Molecular Formula | C20H24F2N4O2 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 3-(4-fluorophenyl)-6-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]hexanoic acid |
| SMILES | O=C(O)CC(CCCN1CCN(c2ncc(F)cn2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H24F2N4O2/c21-17-5-3-15(4-6-17)16(12-19(27)28)2-1-7-25-8-10-26(11-9-25)20-23-13-18(22)14-24-20/h3-6,13-14,16H,1-2,7-12H2,(H,27,28) |
| InChIKey | RGHUWEDUIFWGNE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |