C9H15N3O4 — CID 59148307
7-amino-2-(2-hydroxyacetyl)-1,4-diazonane-5,8-dione (PubChem CID 59148307) has the molecular formula C9H15N3O4 and a molecular weight of 229.24 g/mol. Its IUPAC name is 7-amino-2-(2-hydroxyacetyl)-1,4-diazonane-5,8-dione.
| Compound Name | 7-amino-2-(2-hydroxyacetyl)-1,4-diazonane-5,8-dione |
|---|---|
| PubChem CID | 59148307 |
| Molecular Formula | C9H15N3O4 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 7-amino-2-(2-hydroxyacetyl)-1,4-diazonane-5,8-dione |
| SMILES | NC1CC(=O)NCC(C(=O)CO)NCC1=O |
| InChI | InChI=1S/C9H15N3O4/c10-5-1-9(16)12-2-6(8(15)4-13)11-3-7(5)14/h5-6,11,13H,1-4,10H2,(H,12,16) |
| InChIKey | XVGNWXWXCDBQDM-UHFFFAOYSA-N |
| XLogP | -3.08 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |