C11H18N4O4S — CID 59917688
11-amino-5,8,12-trioxo-1,4,7-triazacyclotridecane-2-carbothioic S-acid (PubChem CID 59917688) has the molecular formula C11H18N4O4S and a molecular weight of 302.36 g/mol. Its IUPAC name is 11-amino-5,8,12-trioxo-1,4,7-triazacyclotridecane-2-carbothioic S-acid.
| Compound Name | 11-amino-5,8,12-trioxo-1,4,7-triazacyclotridecane-2-carbothioic S-acid |
|---|---|
| PubChem CID | 59917688 |
| Molecular Formula | C11H18N4O4S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 11-amino-5,8,12-trioxo-1,4,7-triazacyclotridecane-2-carbothioic S-acid |
| SMILES | NC1CCC(=O)NCC(=O)NCC(C(=O)S)NCC1=O |
| InChI | InChI=1S/C11H18N4O4S/c12-6-1-2-9(17)15-5-10(18)14-3-7(11(19)20)13-4-8(6)16/h6-7,13H,1-5,12H2,(H,14,18)(H,15,17)(H,19,20) |
| InChIKey | VEQJOSNNBPWDNT-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|