C11H17N4O4Y- — CID 59917667
11-amino-7-(oxomethyl)-1,4,8-triazacyclotridecane-3,10,13-trione;yttrium (PubChem CID 59917667) has the molecular formula C11H17N4O4Y- and a molecular weight of 358.19 g/mol. Its IUPAC name is 11-amino-7-(oxomethyl)-1,4,8-triazacyclotridecane-3,10,13-trione;yttrium.
| Compound Name | 11-amino-7-(oxomethyl)-1,4,8-triazacyclotridecane-3,10,13-trione;yttrium |
|---|---|
| PubChem CID | 59917667 |
| Molecular Formula | C11H17N4O4Y- |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 11-amino-7-(oxomethyl)-1,4,8-triazacyclotridecane-3,10,13-trione;yttrium |
| SMILES | NC1CC(=O)NCC(=O)NCCC([C-]=O)NCC1=O.[Y] |
| InChI | InChI=1S/C11H17N4O4.Y/c12-8-3-10(18)15-5-11(19)13-2-1-7(6-16)14-4-9(8)17;/h7-8,14H,1-5,12H2,(H,13,19)(H,15,18);/q-1; |
| InChIKey | NNRVCMOPHYPEMZ-UHFFFAOYSA-N |
| XLogP | -3.03 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|