C10H16N4O4SY-2 — CID 59917702
11-amino-7-(oxomethyl)-1,4,8-triazacyclododecane-2,5,10-trione;sulfanide;yttrium (PubChem CID 59917702) has the molecular formula C10H16N4O4SY-2 and a molecular weight of 377.24 g/mol. Its IUPAC name is 11-amino-7-(oxomethyl)-1,4,8-triazacyclododecane-2,5,10-trione;sulfanide;yttrium.
| Compound Name | 11-amino-7-(oxomethyl)-1,4,8-triazacyclododecane-2,5,10-trione;sulfanide;yttrium |
|---|---|
| PubChem CID | 59917702 |
| Molecular Formula | C10H16N4O4SY-2 |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | 11-amino-7-(oxomethyl)-1,4,8-triazacyclododecane-2,5,10-trione;sulfanide;yttrium |
| SMILES | NC1CNC(=O)CNC(=O)CC([C-]=O)NCC1=O.[SH-].[Y] |
| InChI | InChI=1S/C10H15N4O4.H2S.Y/c11-7-2-13-10(18)4-14-9(17)1-6(5-15)12-3-8(7)16;;/h6-7,12H,1-4,11H2,(H,13,18)(H,14,17);1H2;/q-1;;/p-1 |
| InChIKey | OJSXOFYHPXEDDH-UHFFFAOYSA-M |
| XLogP | -3.69 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|