C12H20N4O4SY-2 — CID 59917672
12-amino-8-(oxomethyl)-1,5,9-triazacyclotetradecane-2,4,11-trione;sulfanide;yttrium (PubChem CID 59917672) has the molecular formula C12H20N4O4SY-2 and a molecular weight of 405.29 g/mol. Its IUPAC name is 12-amino-8-(oxomethyl)-1,5,9-triazacyclotetradecane-2,4,11-trione;sulfanide;yttrium.
| Compound Name | 12-amino-8-(oxomethyl)-1,5,9-triazacyclotetradecane-2,4,11-trione;sulfanide;yttrium |
|---|---|
| PubChem CID | 59917672 |
| Molecular Formula | C12H20N4O4SY-2 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | 12-amino-8-(oxomethyl)-1,5,9-triazacyclotetradecane-2,4,11-trione;sulfanide;yttrium |
| SMILES | NC1CCNC(=O)CC(=O)NCCC([C-]=O)NCC1=O.[SH-].[Y] |
| InChI | InChI=1S/C12H19N4O4.H2S.Y/c13-9-2-4-15-12(20)5-11(19)14-3-1-8(7-17)16-6-10(9)18;;/h8-9,16H,1-6,13H2,(H,14,19)(H,15,20);1H2;/q-1;;/p-1 |
| InChIKey | SQMNGSJDRYXIJG-UHFFFAOYSA-M |
| XLogP | -2.91 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|