C5H9N3O2 — CID 175997562
6-amino-1,4-diazepane-2,5-dione (PubChem CID 175997562) has the molecular formula C5H9N3O2 and a molecular weight of 143.15 g/mol. Its IUPAC name is 6-amino-1,4-diazepane-2,5-dione.
| Compound Name | 6-amino-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 175997562 |
| Molecular Formula | C5H9N3O2 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | 6-amino-1,4-diazepane-2,5-dione |
| SMILES | NC1CNC(=O)CNC1=O |
| InChI | InChI=1S/C5H9N3O2/c6-3-1-7-4(9)2-8-5(3)10/h3H,1-2,6H2,(H,7,9)(H,8,10) |
| InChIKey | TVQNSHHOVYDCPL-UHFFFAOYSA-N |
| XLogP | -2.44 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |