C19H26F8O2 — CID 59148798
1-[[4,4,5,5-tetrafluoro-5-(1,1,2,2-tetrafluoropropoxy)pentoxy]methyl]adamantane (PubChem CID 59148798) has the molecular formula C19H26F8O2 and a molecular weight of 438.40 g/mol. Its IUPAC name is 1-[[4,4,5,5-tetrafluoro-5-(1,1,2,2-tetrafluoropropoxy)pentoxy]methyl]adamantane.
| Compound Name | 1-[[4,4,5,5-tetrafluoro-5-(1,1,2,2-tetrafluoropropoxy)pentoxy]methyl]adamantane |
|---|---|
| PubChem CID | 59148798 |
| Molecular Formula | C19H26F8O2 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 1-[[4,4,5,5-tetrafluoro-5-(1,1,2,2-tetrafluoropropoxy)pentoxy]methyl]adamantane |
| SMILES | CC(F)(F)C(F)(F)OC(F)(F)C(F)(F)CCCOCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H26F8O2/c1-15(20,21)18(24,25)29-19(26,27)17(22,23)3-2-4-28-11-16-8-12-5-13(9-16)7-14(6-12)10-16/h12-14H,2-11H2,1H3 |
| InChIKey | PLRJWVLRCKZWJY-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|