C18H24F8O5S — CID 59491997
1-[4,4,5,5-tetrafluoro-5-(1,1,2,2-tetrafluoro-2-methoxyperoxysulfanylethoxy)pentoxy]adamantane (PubChem CID 59491997) has the molecular formula C18H24F8O5S and a molecular weight of 504.44 g/mol. Its IUPAC name is 1-[4,4,5,5-tetrafluoro-5-(1,1,2,2-tetrafluoro-2-methoxyperoxysulfanylethoxy)pentoxy]adamantane.
| Compound Name | 1-[4,4,5,5-tetrafluoro-5-(1,1,2,2-tetrafluoro-2-methoxyperoxysulfanylethoxy)pentoxy]adamantane |
|---|---|
| PubChem CID | 59491997 |
| Molecular Formula | C18H24F8O5S |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 1-[4,4,5,5-tetrafluoro-5-(1,1,2,2-tetrafluoro-2-methoxyperoxysulfanylethoxy)pentoxy]adamantane |
| SMILES | COOOSC(F)(F)C(F)(F)OC(F)(F)C(F)(F)CCCOC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H24F8O5S/c1-27-30-31-32-18(25,26)17(23,24)29-16(21,22)15(19,20)3-2-4-28-14-8-11-5-12(9-14)7-13(6-11)10-14/h11-13H,2-10H2,1H3 |
| InChIKey | KRXCYOGJNSXWNH-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|