C14H22F2O5S — CID 59440609
1-[[2,2-difluoro-2-(trioxidanylsulfanyl)ethoxy]methyl]-3-methoxyadamantane (PubChem CID 59440609) has the molecular formula C14H22F2O5S and a molecular weight of 340.39 g/mol. Its IUPAC name is 1-[[2,2-difluoro-2-(trioxidanylsulfanyl)ethoxy]methyl]-3-methoxyadamantane.
| Compound Name | 1-[[2,2-difluoro-2-(trioxidanylsulfanyl)ethoxy]methyl]-3-methoxyadamantane |
|---|---|
| PubChem CID | 59440609 |
| Molecular Formula | C14H22F2O5S |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 1-[[2,2-difluoro-2-(trioxidanylsulfanyl)ethoxy]methyl]-3-methoxyadamantane |
| SMILES | COC12CC3CC(CC(COCC(F)(F)SOOO)(C3)C1)C2 |
| InChI | InChI=1S/C14H22F2O5S/c1-18-13-5-10-2-11(6-13)4-12(3-10,7-13)8-19-9-14(15,16)22-21-20-17/h10-11,17H,2-9H2,1H3 |
| InChIKey | ODWXVODSGYHFCJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|