C15H24F2O2 — CID 58225954
1-(2,2-difluoroethoxymethyl)-3-ethoxyadamantane (PubChem CID 58225954) has the molecular formula C15H24F2O2 and a molecular weight of 274.35 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxymethyl)-3-ethoxyadamantane.
| Compound Name | 1-(2,2-difluoroethoxymethyl)-3-ethoxyadamantane |
|---|---|
| PubChem CID | 58225954 |
| Molecular Formula | C15H24F2O2 |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-(2,2-difluoroethoxymethyl)-3-ethoxyadamantane |
| SMILES | CCOC12CC3CC(CC(COCC(F)F)(C3)C1)C2 |
| InChI | InChI=1S/C15H24F2O2/c1-2-19-15-6-11-3-12(7-15)5-14(4-11,9-15)10-18-8-13(16)17/h11-13H,2-10H2,1H3 |
| InChIKey | PKERTZDIHCTYFM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |