C16H26F2O6S — CID 59440643
1-[[2,2-difluoro-2-(trioxidanylsulfanyl)ethoxy]methyl]-3-ethoxy-5-methoxyadamantane (PubChem CID 59440643) has the molecular formula C16H26F2O6S and a molecular weight of 384.44 g/mol. Its IUPAC name is 1-[[2,2-difluoro-2-(trioxidanylsulfanyl)ethoxy]methyl]-3-ethoxy-5-methoxyadamantane.
| Compound Name | 1-[[2,2-difluoro-2-(trioxidanylsulfanyl)ethoxy]methyl]-3-ethoxy-5-methoxyadamantane |
|---|---|
| PubChem CID | 59440643 |
| Molecular Formula | C16H26F2O6S |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 1-[[2,2-difluoro-2-(trioxidanylsulfanyl)ethoxy]methyl]-3-ethoxy-5-methoxyadamantane |
| SMILES | CCOC12CC3CC(COCC(F)(F)SOOO)(CC(OC)(C3)C1)C2 |
| InChI | InChI=1S/C16H26F2O6S/c1-3-22-15-6-12-4-13(8-15,7-14(5-12,9-15)20-2)10-21-11-16(17,18)25-24-23-19/h12,19H,3-11H2,1-2H3 |
| InChIKey | BKTNVIUSSNDSRB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|