C18H16NiS4-4 — CID 59155738
bis((Z)-1-(4-methylphenyl)ethene-1,2-dithiolate);nickel (PubChem CID 59155738) has the molecular formula C18H16NiS4-4 and a molecular weight of 419.29 g/mol. Its IUPAC name is bis((Z)-1-(4-methylphenyl)ethene-1,2-dithiolate);nickel.
| Compound Name | bis((Z)-1-(4-methylphenyl)ethene-1,2-dithiolate);nickel |
|---|---|
| PubChem CID | 59155738 |
| Molecular Formula | C18H16NiS4-4 |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 417.95 |
| IUPAC Name | bis((Z)-1-(4-methylphenyl)ethene-1,2-dithiolate);nickel |
| SMILES | Cc1ccc(/C([S-])=C/[S-])cc1.Cc1ccc(/C([S-])=C/[S-])cc1.[Ni] |
| InChI | InChI=1S/2C9H10S2.Ni/c2*1-7-2-4-8(5-3-7)9(11)6-10;/h2*2-6,10-11H,1H3;/p-4/b2*9-6-; |
| InChIKey | LAAOFSNSDOBWTC-MMEIPCRISA-J |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|