C37H68O6P2S2Sn — CID 59155831
tributyl-[3-dibutoxyphosphoryl-5-(3-dibutoxyphosphoryl-5-methylthiophen-2-yl)thiophen-2-yl]stannane (PubChem CID 59155831) has the molecular formula C37H68O6P2S2Sn and a molecular weight of 853.74 g/mol. Its IUPAC name is tributyl-[3-dibutoxyphosphoryl-5-(3-dibutoxyphosphoryl-5-methylthiophen-2-yl)thiophen-2-yl]stannane.
| Compound Name | tributyl-[3-dibutoxyphosphoryl-5-(3-dibutoxyphosphoryl-5-methylthiophen-2-yl)thiophen-2-yl]stannane |
|---|---|
| PubChem CID | 59155831 |
| Molecular Formula | C37H68O6P2S2Sn |
| Molecular Weight | 853.74 g/mol |
| Exact Mass | 854.30 |
| IUPAC Name | tributyl-[3-dibutoxyphosphoryl-5-(3-dibutoxyphosphoryl-5-methylthiophen-2-yl)thiophen-2-yl]stannane |
| SMILES | CCCCOP(=O)(OCCCC)c1cc(C)sc1-c1cc(P(=O)(OCCCC)OCCCC)c([Sn](CCCC)(CCCC)CCCC)s1 |
| InChI | InChI=1S/C25H41O6P2S2.3C4H9.Sn/c1-6-10-14-28-32(26,29-15-11-7-2)22-19-24(34-20-22)25-23(18-21(5)35-25)33(27,30-16-12-8-3)31-17-13-9-4;3*1-3-4-2;/h18-19H,6-17H2,1-5H3;3*1,3-4H2,2H3; |
| InChIKey | CPBJNNXUSCZIHE-UHFFFAOYSA-N |
| XLogP | 12.74 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.74 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|