C20H24I2O6P2S3 — CID 59155829
3,4-bis(diethoxyphosphoryl)-2,5-bis(5-iodothiophen-2-yl)thiophene (PubChem CID 59155829) has the molecular formula C20H24I2O6P2S3 and a molecular weight of 772.36 g/mol. Its IUPAC name is 3,4-bis(diethoxyphosphoryl)-2,5-bis(5-iodothiophen-2-yl)thiophene.
| Compound Name | 3,4-bis(diethoxyphosphoryl)-2,5-bis(5-iodothiophen-2-yl)thiophene |
|---|---|
| PubChem CID | 59155829 |
| Molecular Formula | C20H24I2O6P2S3 |
| Molecular Weight | 772.36 g/mol |
| Exact Mass | 771.83 |
| IUPAC Name | 3,4-bis(diethoxyphosphoryl)-2,5-bis(5-iodothiophen-2-yl)thiophene |
| SMILES | CCOP(=O)(OCC)c1c(-c2ccc(I)s2)sc(-c2ccc(I)s2)c1P(=O)(OCC)OCC |
| InChI | InChI=1S/C20H24I2O6P2S3/c1-5-25-29(23,26-6-2)17-18(30(24,27-7-3)28-8-4)20(14-10-12-16(22)32-14)33-19(17)13-9-11-15(21)31-13/h9-12H,5-8H2,1-4H3 |
| InChIKey | HYUAUQCTEFPZAZ-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.36 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|