C29H52O6P2S2Sn — CID 59155850
tributyl-[3-diethoxyphosphoryl-5-(3-diethoxyphosphoryl-5-methylthiophen-2-yl)thiophen-2-yl]stannane (PubChem CID 59155850) has the molecular formula C29H52O6P2S2Sn and a molecular weight of 741.52 g/mol. Its IUPAC name is tributyl-[3-diethoxyphosphoryl-5-(3-diethoxyphosphoryl-5-methylthiophen-2-yl)thiophen-2-yl]stannane.
| Compound Name | tributyl-[3-diethoxyphosphoryl-5-(3-diethoxyphosphoryl-5-methylthiophen-2-yl)thiophen-2-yl]stannane |
|---|---|
| PubChem CID | 59155850 |
| Molecular Formula | C29H52O6P2S2Sn |
| Molecular Weight | 741.52 g/mol |
| Exact Mass | 742.17 |
| IUPAC Name | tributyl-[3-diethoxyphosphoryl-5-(3-diethoxyphosphoryl-5-methylthiophen-2-yl)thiophen-2-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1sc(-c2sc(C)cc2P(=O)(OCC)OCC)cc1P(=O)(OCC)OCC |
| InChI | InChI=1S/C17H25O6P2S2.3C4H9.Sn/c1-6-20-24(18,21-7-2)14-11-16(26-12-14)17-15(10-13(5)27-17)25(19,22-8-3)23-9-4;3*1-3-4-2;/h10-11H,6-9H2,1-5H3;3*1,3-4H2,2H3; |
| InChIKey | CWWGVPRXKMCJEV-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.52 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|