C24H24N2O4S — CID 59156554
N-[4-[(E)-2-[3,3-dimethyl-7-(2-oxo-1H-pyridin-3-yl)-2H-1-benzofuran-5-yl]ethenyl]phenyl]methanesulfonamide (PubChem CID 59156554) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is N-[4-[(E)-2-[3,3-dimethyl-7-(2-oxo-1H-pyridin-3-yl)-2H-1-benzofuran-5-yl]ethenyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(E)-2-[3,3-dimethyl-7-(2-oxo-1H-pyridin-3-yl)-2H-1-benzofuran-5-yl]ethenyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 59156554 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-[4-[(E)-2-[3,3-dimethyl-7-(2-oxo-1H-pyridin-3-yl)-2H-1-benzofuran-5-yl]ethenyl]phenyl]methanesulfonamide |
| SMILES | CC1(C)COc2c(-c3ccc[nH]c3=O)cc(/C=C/c3ccc(NS(C)(=O)=O)cc3)cc21 |
| InChI | InChI=1S/C24H24N2O4S/c1-24(2)15-30-22-20(19-5-4-12-25-23(19)27)13-17(14-21(22)24)7-6-16-8-10-18(11-9-16)26-31(3,28)29/h4-14,26H,15H2,1-3H3,(H,25,27)/b7-6+ |
| InChIKey | UKPWPLREHNWAER-VOTSOKGWSA-N |
| XLogP | 4.25 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|