C24H32N6O8 — CID 59156937
N,N'-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-methylpentanediamide (PubChem CID 59156937) has the molecular formula C24H32N6O8 and a molecular weight of 532.55 g/mol. Its IUPAC name is N,N'-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-methylpentanediamide.
| Compound Name | N,N'-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-methylpentanediamide |
|---|---|
| PubChem CID | 59156937 |
| Molecular Formula | C24H32N6O8 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | N,N'-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-methylpentanediamide |
| SMILES | CC(CC(=O)NCCNC(=O)CCN1C(=O)C=CC1=O)CC(=O)NCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C24H32N6O8/c1-16(14-19(33)27-10-8-25-17(31)6-12-29-21(35)2-3-22(29)36)15-20(34)28-11-9-26-18(32)7-13-30-23(37)4-5-24(30)38/h2-5,16H,6-15H2,1H3,(H,25,31)(H,26,32)(H,27,33)(H,28,34) |
| InChIKey | CRDKGRIGVLJRKF-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 191.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|