C23H27N3 — CID 59157450
4-[amino-[4-(methylaminomethyl)phenyl]-phenylmethyl]-N,N-dimethylaniline (PubChem CID 59157450) has the molecular formula C23H27N3 and a molecular weight of 345.49 g/mol. Its IUPAC name is 4-[amino-[4-(methylaminomethyl)phenyl]-phenylmethyl]-N,N-dimethylaniline.
| Compound Name | 4-[amino-[4-(methylaminomethyl)phenyl]-phenylmethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 59157450 |
| Molecular Formula | C23H27N3 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 4-[amino-[4-(methylaminomethyl)phenyl]-phenylmethyl]-N,N-dimethylaniline |
| SMILES | CNCc1ccc(C(N)(c2ccccc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H27N3/c1-25-17-18-9-11-20(12-10-18)23(24,19-7-5-4-6-8-19)21-13-15-22(16-14-21)26(2)3/h4-16,25H,17,24H2,1-3H3 |
| InChIKey | ORPYUIWJJIDTNF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|