C16H19F3N2 — CID 143206265
N-methyl-1-phenylmethanamine;N-methyl-4-(trifluoromethyl)aniline (PubChem CID 143206265) has the molecular formula C16H19F3N2 and a molecular weight of 296.34 g/mol. Its IUPAC name is N-methyl-1-phenylmethanamine;N-methyl-4-(trifluoromethyl)aniline.
| Compound Name | N-methyl-1-phenylmethanamine;N-methyl-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 143206265 |
| Molecular Formula | C16H19F3N2 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N-methyl-1-phenylmethanamine;N-methyl-4-(trifluoromethyl)aniline |
| SMILES | CNCc1ccccc1.CNc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C8H8F3N.C8H11N/c1-12-7-4-2-6(3-5-7)8(9,10)11;1-9-7-8-5-3-2-4-6-8/h2-5,12H,1H3;2-6,9H,7H2,1H3 |
| InChIKey | FHGVPGKHLIWDKS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |