C15H16F3N2+ — CID 143526238
[(R)-(benzylamino)-[4-(trifluoromethyl)phenyl]methyl]azanium (PubChem CID 143526238) has the molecular formula C15H16F3N2+ and a molecular weight of 281.30 g/mol. Its IUPAC name is [(R)-(benzylamino)-[4-(trifluoromethyl)phenyl]methyl]azanium.
| Compound Name | [(R)-(benzylamino)-[4-(trifluoromethyl)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 143526238 |
| Molecular Formula | C15H16F3N2+ |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | [(R)-(benzylamino)-[4-(trifluoromethyl)phenyl]methyl]azanium |
| SMILES | [NH3+][C@H](NCc1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H15F3N2/c16-15(17,18)13-8-6-12(7-9-13)14(19)20-10-11-4-2-1-3-5-11/h1-9,14,20H,10,19H2/p+1/t14-/m1/s1 |
| InChIKey | YISGJQBEIQBTJK-CQSZACIVSA-O |
| XLogP | 2.74 |
| TPSA | 39.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|