C26H24N4O3S2 — CID 59161023
ethyl 4-[4-[[3-cyano-5-isocyano-6-methyl-4-(oxan-2-yl)-2-pyridinyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzoate (PubChem CID 59161023) has the molecular formula C26H24N4O3S2 and a molecular weight of 504.64 g/mol. Its IUPAC name is ethyl 4-[4-[[3-cyano-5-isocyano-6-methyl-4-(oxan-2-yl)-2-pyridinyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzoate.
| Compound Name | ethyl 4-[4-[[3-cyano-5-isocyano-6-methyl-4-(oxan-2-yl)-2-pyridinyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzoate |
|---|---|
| PubChem CID | 59161023 |
| Molecular Formula | C26H24N4O3S2 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | ethyl 4-[4-[[3-cyano-5-isocyano-6-methyl-4-(oxan-2-yl)-2-pyridinyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzoate |
| SMILES | [C-]#[N+]c1c(C)nc(SCc2csc(-c3ccc(C(=O)OCC)cc3)n2)c(C#N)c1C1CCCCO1 |
| InChI | InChI=1S/C26H24N4O3S2/c1-4-32-26(31)18-10-8-17(9-11-18)24-30-19(14-34-24)15-35-25-20(13-27)22(21-7-5-6-12-33-21)23(28-3)16(2)29-25/h8-11,14,21H,4-7,12,15H2,1-2H3 |
| InChIKey | LJVULZPHBALDLV-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|