C12H11BrF2IrN3- — CID 59165279
3-bromo-5-(2,4-difluorobenzene-6-id-1-yl)-1-(2-methylpropyl)-1,2,4-triazole;iridium (PubChem CID 59165279) has the molecular formula C12H11BrF2IrN3- and a molecular weight of 507.36 g/mol. Its IUPAC name is 3-bromo-5-(2,4-difluorobenzene-6-id-1-yl)-1-(2-methylpropyl)-1,2,4-triazole;iridium.
| Compound Name | 3-bromo-5-(2,4-difluorobenzene-6-id-1-yl)-1-(2-methylpropyl)-1,2,4-triazole;iridium |
|---|---|
| PubChem CID | 59165279 |
| Molecular Formula | C12H11BrF2IrN3- |
| Molecular Weight | 507.36 g/mol |
| Exact Mass | 506.97 |
| IUPAC Name | 3-bromo-5-(2,4-difluorobenzene-6-id-1-yl)-1-(2-methylpropyl)-1,2,4-triazole;iridium |
| SMILES | CC(C)Cn1nc(Br)nc1-c1[c-]cc(F)cc1F.[Ir] |
| InChI | InChI=1S/C12H11BrF2N3.Ir/c1-7(2)6-18-11(16-12(13)17-18)9-4-3-8(14)5-10(9)15;/h3,5,7H,6H2,1-2H3;/q-1; |
| InChIKey | GXAMZMFVXHHZKI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|