C16H18N2O — CID 59168384
11-amino-1-azatetracyclo[7.7.1.02,8.013,17]heptadeca-2(8),9,11,13(17)-tetraen-3-one (PubChem CID 59168384) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 11-amino-1-azatetracyclo[7.7.1.02,8.013,17]heptadeca-2(8),9,11,13(17)-tetraen-3-one.
| Compound Name | 11-amino-1-azatetracyclo[7.7.1.02,8.013,17]heptadeca-2(8),9,11,13(17)-tetraen-3-one |
|---|---|
| PubChem CID | 59168384 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 11-amino-1-azatetracyclo[7.7.1.02,8.013,17]heptadeca-2(8),9,11,13(17)-tetraen-3-one |
| SMILES | Nc1cc2c3c(c1)c1c(n3CCC2)C(=O)CCCC1 |
| InChI | InChI=1S/C16H18N2O/c17-11-8-10-4-3-7-18-15(10)13(9-11)12-5-1-2-6-14(19)16(12)18/h8-9H,1-7,17H2 |
| InChIKey | BBLHUWOHAXFXIY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|