C37H55N3O5 — CID 59176137
3-[(1S,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]cyclohexyl]-2,2-dimethyl-N-(1-methylpiperidin-4-yl)propanamide (PubChem CID 59176137) has the molecular formula C37H55N3O5 and a molecular weight of 621.86 g/mol. Its IUPAC name is 3-[(1S,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]cyclohexyl]-2,2-dimethyl-N-(1-methylpiperidin-4-yl)propanamide.
| Compound Name | 3-[(1S,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]cyclohexyl]-2,2-dimethyl-N-(1-methylpiperidin-4-yl)propanamide |
|---|---|
| PubChem CID | 59176137 |
| Molecular Formula | C37H55N3O5 |
| Molecular Weight | 621.86 g/mol |
| Exact Mass | 621.41 |
| IUPAC Name | 3-[(1S,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]cyclohexyl]-2,2-dimethyl-N-(1-methylpiperidin-4-yl)propanamide |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CC[C@H](CC(C)(C)C(=O)NC4CCN(C)CC4)C[C@@H]3c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C37H55N3O5/c1-37(2,36(41)38-30-15-18-39(3)19-16-30)25-27-7-13-34(32(23-27)29-9-11-31(43-5)12-10-29)45-26-28-8-14-35-33(24-28)40(20-22-44-35)17-6-21-42-4/h8-12,14,24,27,30,32,34H,6-7,13,15-23,25-26H2,1-5H3,(H,38,41)/t27-,32+,34-/m0/s1 |
| InChIKey | IFAGENVEDLDCLQ-YBLXTWFBSA-N |
| XLogP | 6.03 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.86 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|