About (E)-3-ethyl-4-methylhept-3-en-1,5-diyne
(E)-3-ethyl-4-methylhept-3-en-1,5-diyne (PubChem CID 59189068) has the molecular formula C10H12
and a molecular weight of 132.21 g/mol. Its IUPAC name is (E)-3-ethyl-4-methylhept-3-en-1,5-diyne.
Molecular Properties
| Compound Name | (E)-3-ethyl-4-methylhept-3-en-1,5-diyne |
| PubChem CID | 59189068 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | (E)-3-ethyl-4-methylhept-3-en-1,5-diyne |
| SMILES | C#C/C(CC)=C(\C)C#CC |
| InChI | InChI=1S/C10H12/c1-5-8-9(4)10(6-2)7-3/h2H,7H2,1,3-4H3/b10-9- |
| InChIKey | ZKKLXQLWPMONQD-KTKRTIGZSA-N |
| XLogP | 2.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-ethyl-4-methylhept-3-en-1,5-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-ethyl-4-methylhept-3-en-1,5-diyne?
The IUPAC name of (E)-3-ethyl-4-methylhept-3-en-1,5-diyne (CID 59189068) is (E)-3-ethyl-4-methylhept-3-en-1,5-diyne.
What is the SMILES notation for (E)-3-ethyl-4-methylhept-3-en-1,5-diyne?
The canonical SMILES for (E)-3-ethyl-4-methylhept-3-en-1,5-diyne is C#C/C(CC)=C(\C)C#CC.
What is the InChIKey of (E)-3-ethyl-4-methylhept-3-en-1,5-diyne?
The InChIKey is ZKKLXQLWPMONQD-KTKRTIGZSA-N. The full InChI is InChI=1S/C10H12/c1-5-8-9(4)10(6-2)7-3/h2H,7H2,1,3-4H3/b10-9-.
What are the key properties of (E)-3-ethyl-4-methylhept-3-en-1,5-diyne?
(E)-3-ethyl-4-methylhept-3-en-1,5-diyne has a molecular weight of 132.21 g/mol, XLogP of 2.37, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-ethyl-4-methylhept-3-en-1,5-diyne is sourced from PubChem (CID 59189068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).