C21H31N3O3S — CID 59192473
4-[[2-(2,2-dimethylpropyl)-5-ethylsulfonylbenzimidazol-1-yl]methyl]piperidine-1-carbaldehyde (PubChem CID 59192473) has the molecular formula C21H31N3O3S and a molecular weight of 405.56 g/mol. Its IUPAC name is 4-[[2-(2,2-dimethylpropyl)-5-ethylsulfonylbenzimidazol-1-yl]methyl]piperidine-1-carbaldehyde.
| Compound Name | 4-[[2-(2,2-dimethylpropyl)-5-ethylsulfonylbenzimidazol-1-yl]methyl]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 59192473 |
| Molecular Formula | C21H31N3O3S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 4-[[2-(2,2-dimethylpropyl)-5-ethylsulfonylbenzimidazol-1-yl]methyl]piperidine-1-carbaldehyde |
| SMILES | CCS(=O)(=O)c1ccc2c(c1)nc(CC(C)(C)C)n2CC1CCN(C=O)CC1 |
| InChI | InChI=1S/C21H31N3O3S/c1-5-28(26,27)17-6-7-19-18(12-17)22-20(13-21(2,3)4)24(19)14-16-8-10-23(15-25)11-9-16/h6-7,12,15-16H,5,8-11,13-14H2,1-4H3 |
| InChIKey | HWJNDVSYLBRNRO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|