C22H32N2O5S — CID 87607486
[2-(2,2-dimethylpropyl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]sulfonyl 2-methylpropanoate (PubChem CID 87607486) has the molecular formula C22H32N2O5S and a molecular weight of 436.57 g/mol. Its IUPAC name is [2-(2,2-dimethylpropyl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]sulfonyl 2-methylpropanoate.
| Compound Name | [2-(2,2-dimethylpropyl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]sulfonyl 2-methylpropanoate |
|---|---|
| PubChem CID | 87607486 |
| Molecular Formula | C22H32N2O5S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | [2-(2,2-dimethylpropyl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]sulfonyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OS(=O)(=O)c1ccc2c(c1)nc(CC(C)(C)C)n2CC1CCOCC1 |
| InChI | InChI=1S/C22H32N2O5S/c1-15(2)21(25)29-30(26,27)17-6-7-19-18(12-17)23-20(13-22(3,4)5)24(19)14-16-8-10-28-11-9-16/h6-7,12,15-16H,8-11,13-14H2,1-5H3 |
| InChIKey | MGVZPDBCWRWFAR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|