C19H26N2O2S — CID 91398055
[1-(cyclopropylmethyl)-2-(2,2-dimethylpropyl)benzimidazol-5-yl]sulfanyl propanoate (PubChem CID 91398055) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is [1-(cyclopropylmethyl)-2-(2,2-dimethylpropyl)benzimidazol-5-yl]sulfanyl propanoate.
| Compound Name | [1-(cyclopropylmethyl)-2-(2,2-dimethylpropyl)benzimidazol-5-yl]sulfanyl propanoate |
|---|---|
| PubChem CID | 91398055 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | [1-(cyclopropylmethyl)-2-(2,2-dimethylpropyl)benzimidazol-5-yl]sulfanyl propanoate |
| SMILES | CCC(=O)OSc1ccc2c(c1)nc(CC(C)(C)C)n2CC1CC1 |
| InChI | InChI=1S/C19H26N2O2S/c1-5-18(22)23-24-14-8-9-16-15(10-14)20-17(11-19(2,3)4)21(16)12-13-6-7-13/h8-10,13H,5-7,11-12H2,1-4H3 |
| InChIKey | VCQNXKIUTWHRNG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|