C33H42ClN3O5 — CID 59201538
2-[(R)-(3-chlorophenyl)-[(3R)-1-[[(2S)-1-cyclohexyl-3-(dimethylamino)propan-2-yl]carbamoyl]piperidin-3-yl]methoxy]ethyl hexa-1,3,5-triynyl carbonate (PubChem CID 59201538) has the molecular formula C33H42ClN3O5 and a molecular weight of 596.17 g/mol. Its IUPAC name is 2-[(R)-(3-chlorophenyl)-[(3R)-1-[[(2S)-1-cyclohexyl-3-(dimethylamino)propan-2-yl]carbamoyl]piperidin-3-yl]methoxy]ethyl hexa-1,3,5-triynyl carbonate.
| Compound Name | 2-[(R)-(3-chlorophenyl)-[(3R)-1-[[(2S)-1-cyclohexyl-3-(dimethylamino)propan-2-yl]carbamoyl]piperidin-3-yl]methoxy]ethyl hexa-1,3,5-triynyl carbonate |
|---|---|
| PubChem CID | 59201538 |
| Molecular Formula | C33H42ClN3O5 |
| Molecular Weight | 596.17 g/mol |
| Exact Mass | 595.28 |
| IUPAC Name | 2-[(R)-(3-chlorophenyl)-[(3R)-1-[[(2S)-1-cyclohexyl-3-(dimethylamino)propan-2-yl]carbamoyl]piperidin-3-yl]methoxy]ethyl hexa-1,3,5-triynyl carbonate |
| SMILES | C#CC#CC#COC(=O)OCCO[C@@H](c1cccc(Cl)c1)[C@@H]1CCCN(C(=O)N[C@@H](CC2CCCCC2)CN(C)C)C1 |
| InChI | InChI=1S/C33H42ClN3O5/c1-4-5-6-10-19-41-33(39)42-21-20-40-31(27-15-11-17-29(34)23-27)28-16-12-18-37(24-28)32(38)35-30(25-36(2)3)22-26-13-8-7-9-14-26/h1,11,15,17,23,26,28,30-31H,7-9,12-14,16,18,20-22,24-25H2,2-3H3,(H,35,38)/t28-,30+,31+/m1/s1 |
| InChIKey | XHOWLLTUSWNPLA-LMERMFHRSA-N |
| XLogP | 5.47 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.17 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|