C34H36O8S — CID 59215337
[2-[4-(4-methoxyphenyl)sulfonylphenoxy]-3-methyl-5-(3,4,5-trimethylphenyl)phenyl] 2-(2-methoxyethoxy)acetate (PubChem CID 59215337) has the molecular formula C34H36O8S and a molecular weight of 604.72 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)sulfonylphenoxy]-3-methyl-5-(3,4,5-trimethylphenyl)phenyl] 2-(2-methoxyethoxy)acetate.
| Compound Name | [2-[4-(4-methoxyphenyl)sulfonylphenoxy]-3-methyl-5-(3,4,5-trimethylphenyl)phenyl] 2-(2-methoxyethoxy)acetate |
|---|---|
| PubChem CID | 59215337 |
| Molecular Formula | C34H36O8S |
| Molecular Weight | 604.72 g/mol |
| Exact Mass | 604.21 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)sulfonylphenoxy]-3-methyl-5-(3,4,5-trimethylphenyl)phenyl] 2-(2-methoxyethoxy)acetate |
| SMILES | COCCOCC(=O)Oc1cc(-c2cc(C)c(C)c(C)c2)cc(C)c1Oc1ccc(S(=O)(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H36O8S/c1-22-17-26(18-23(2)25(22)4)27-19-24(3)34(32(20-27)42-33(35)21-40-16-15-38-5)41-29-9-13-31(14-10-29)43(36,37)30-11-7-28(39-6)8-12-30/h7-14,17-20H,15-16,21H2,1-6H3 |
| InChIKey | UCYPZWCCKURNLO-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.72 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|