C17H17F3O6S — CID 59219009
methyl 2-[3-[3-[dihydroxy(trifluoromethyl)-λ4-sulfanyl]oxy-4-methoxyphenyl]phenyl]acetate (PubChem CID 59219009) has the molecular formula C17H17F3O6S and a molecular weight of 406.38 g/mol. Its IUPAC name is methyl 2-[3-[3-[dihydroxy(trifluoromethyl)-λ4-sulfanyl]oxy-4-methoxyphenyl]phenyl]acetate.
| Compound Name | methyl 2-[3-[3-[dihydroxy(trifluoromethyl)-λ4-sulfanyl]oxy-4-methoxyphenyl]phenyl]acetate |
|---|---|
| PubChem CID | 59219009 |
| Molecular Formula | C17H17F3O6S |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | methyl 2-[3-[3-[dihydroxy(trifluoromethyl)-λ4-sulfanyl]oxy-4-methoxyphenyl]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(-c2ccc(OC)c(OS(O)(O)C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H17F3O6S/c1-24-14-7-6-13(10-15(14)26-27(22,23)17(18,19)20)12-5-3-4-11(8-12)9-16(21)25-2/h3-8,10,22-23H,9H2,1-2H3 |
| InChIKey | DKFASTJGNBFVEB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |