C58H38GeN6 — CID 59221906
bis(10,12-diphenyl-1,9,10-triazatetracyclo[6.5.1.02,7.011,14]tetradeca-2(7),3,5,8,11(14),12-hexaen-5-yl)-diphenylgermane (PubChem CID 59221906) has the molecular formula C58H38GeN6 and a molecular weight of 891.59 g/mol. Its IUPAC name is bis(10,12-diphenyl-1,9,10-triazatetracyclo[6.5.1.02,7.011,14]tetradeca-2(7),3,5,8,11(14),12-hexaen-5-yl)-diphenylgermane.
| Compound Name | bis(10,12-diphenyl-1,9,10-triazatetracyclo[6.5.1.02,7.011,14]tetradeca-2(7),3,5,8,11(14),12-hexaen-5-yl)-diphenylgermane |
|---|---|
| PubChem CID | 59221906 |
| Molecular Formula | C58H38GeN6 |
| Molecular Weight | 891.59 g/mol |
| Exact Mass | 892.24 |
| IUPAC Name | bis(10,12-diphenyl-1,9,10-triazatetracyclo[6.5.1.02,7.011,14]tetradeca-2(7),3,5,8,11(14),12-hexaen-5-yl)-diphenylgermane |
| SMILES | c1ccc(-c2cn3c4ccc([Ge](c5ccccc5)(c5ccccc5)c5ccc6c(c5)c5nn(-c7ccccc7)c7c(-c8ccccc8)cn6c57)cc4c4nn(-c5ccccc5)c2c43)cc1 |
| InChI | InChI=1S/C58H38GeN6/c1-7-19-39(20-8-1)49-37-62-51-33-31-43(35-47(51)53-57(62)55(49)64(60-53)45-27-15-5-16-28-45)59(41-23-11-3-12-24-41,42-25-13-4-14-26-42)44-32-34-52-48(36-44)54-58-56(65(61-54)46-29-17-6-18-30-46)50(38-63(52)58)40-21-9-2-10-22-40/h1-38H |
| InChIKey | MBELNGXTIYTDPO-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 44.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.59 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |